summaryrefslogtreecommitdiffstats
path: root/fs (follow)
Commit message (Collapse)AuthorAgeFilesLines
* Remove 'type' argument from access_ok() functionLinus Torvalds2019-01-0412-32/+26
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Nobody has actually used the type (VERIFY_READ vs VERIFY_WRITE) argument of the user address range verification function since we got rid of the old racy i386-only code to walk page tables by hand. It existed because the original 80386 would not honor the write protect bit when in kernel mode, so you had to do COW by hand before doing any user access. But we haven't supported that in a long time, and these days the 'type' argument is a purely historical artifact. A discussion about extending 'user_access_begin()' to do the range checking resulted this patch, because there is no way we're going to move the old VERIFY_xyz interface to that model. And it's best done at the end of the merge window when I've done most of my merges, so let's just get this done once and for all. This patch was mostly done with a sed-script, with manual fix-ups for the cases that weren't of the trivial 'access_ok(VERIFY_xyz' form. There were a couple of notable cases: - csky still had the old "verify_area()" name as an alias. - the iter_iov code had magical hardcoded knowledge of the actual values of VERIFY_{READ,WRITE} (not that they mattered, since nothing really used it) - microblaze used the type argument for a debug printout but other than those oddities this should be a total no-op patch. I tried to fix up all architectures, did fairly extensive grepping for access_ok() uses, and the changes are trivial, but I may have missed something. Any missed conversion should be trivially fixable, though. Signed-off-by: Linus Torvalds <torvalds@linux-foundation.org>
* Merge tag 'locks-v4.21-2' of ā†µLinus Torvalds2019-01-031-1/+1
|\ | | | | | | | | | | | | | | | | | | | | git://git.kernel.org/pub/scm/linux/kernel/git/jlayton/linux Pull file locking bugfix from Jeff Layton: "This is a one-line fix for a bug that syzbot turned up in the new patches to mitigate the thundering herd when a lock is released" * tag 'locks-v4.21-2' of git://git.kernel.org/pub/scm/linux/kernel/git/jlayton/linux: locks: fix error in locks_move_blocks()
| * locks: fix error in locks_move_blocks()NeilBrown2019-01-031-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | After moving all requests from fl->fl_blocked_requests to new->fl_blocked_requests it is nonsensical to do anything to all the remaining elements, there aren't any. This should do something to all the requests that have been moved. For simplicity, it does it to all requests in the target list. Setting "f->fl_blocker = new" to all members of new->fl_blocked_requests is "obviously correct" as it preserves the invariant of the linkage among requests. Reported-by: syzbot+239d99847eb49ecb3899@syzkaller.appspotmail.com Fixes: 5946c4319ebb ("fs/locks: allow a lock request to block other requests.") Signed-off-by: NeilBrown <neilb@suse.com> Signed-off-by: Jeff Layton <jlayton@kernel.org>
* | Merge tag 'nfs-for-4.21-1' of git://git.linux-nfs.org/projects/anna/linux-nfsLinus Torvalds2019-01-0330-531/+660
|\ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Pull NFS client updates from Anna Schumaker: "Stable bugfixes: - xprtrdma: Yet another double DMA-unmap # v4.20 Features: - Allow some /proc/sys/sunrpc entries without CONFIG_SUNRPC_DEBUG - Per-xprt rdma receive workqueues - Drop support for FMR memory registration - Make port= mount option optional for RDMA mounts Other bugfixes and cleanups: - Remove unused nfs4_xdev_fs_type declaration - Fix comments for behavior that has changed - Remove generic RPC credentials by switching to 'struct cred' - Fix crossing mountpoints with different auth flavors - Various xprtrdma fixes from testing and auditing the close code - Fixes for disconnect issues when using xprtrdma with krb5 - Clean up and improve xprtrdma trace points - Fix NFS v4.2 async copy reboot recovery" * tag 'nfs-for-4.21-1' of git://git.linux-nfs.org/projects/anna/linux-nfs: (63 commits) sunrpc: convert to DEFINE_SHOW_ATTRIBUTE sunrpc: Add xprt after nfs4_test_session_trunk() sunrpc: convert unnecessary GFP_ATOMIC to GFP_NOFS sunrpc: handle ENOMEM in rpcb_getport_async NFS: remove unnecessary test for IS_ERR(cred) xprtrdma: Prevent leak of rpcrdma_rep objects NFSv4.2 fix async copy reboot recovery xprtrdma: Don't leak freed MRs xprtrdma: Add documenting comment for rpcrdma_buffer_destroy xprtrdma: Replace outdated comment for rpcrdma_ep_post xprtrdma: Update comments in frwr_op_send SUNRPC: Fix some kernel doc complaints SUNRPC: Simplify defining common RPC trace events NFS: Fix NFSv4 symbolic trace point output xprtrdma: Trace mapping, alloc, and dereg failures xprtrdma: Add trace points for calls to transport switch methods xprtrdma: Relocate the xprtrdma_mr_map trace points xprtrdma: Clean up of xprtrdma chunk trace points xprtrdma: Remove unused fields from rpcrdma_ia xprtrdma: Cull dprintk() call sites ...
| * | sunrpc: Add xprt after nfs4_test_session_trunk()Santosh kumar pradhan2019-01-023-7/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Multipathing: In case of NFSv3, rpc_clnt_test_and_add_xprt() adds the xprt to xprt switch (i.e. xps) if rpc_call_null_helper() returns success. But in case of NFSv4.1, it needs to do EXCHANGEID to verify the path along with check for session trunking. Add the xprt in nfs4_test_session_trunk() only when nfs4_detect_session_trunking() returns success. Also release refcount hold by rpc_clnt_setup_test_and_add_xprt(). Signed-off-by: Santosh kumar pradhan <santoshkumar.pradhan@wdc.com> Tested-by: Suresh Jayaraman <suresh.jayaraman@wdc.com> Reported-by: Aditya Agnihotri <aditya.agnihotri@wdc.com> Signed-off-by: Anna Schumaker <Anna.Schumaker@Netapp.com>
| * | NFS: remove unnecessary test for IS_ERR(cred)NeilBrown2019-01-021-5/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | As gte_current_cred() cannot return an error, this test is not necessary. It hasn't been necessary for years, but it wasn't so obvious before. Reported-by: Dan Carpenter <dan.carpenter@oracle.com> Signed-off-by: NeilBrown <neilb@suse.com> Signed-off-by: Anna Schumaker <Anna.Schumaker@Netapp.com>
| * | NFSv4.2 fix async copy reboot recoveryOlga Kornievskaia2019-01-021-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Original commit (e4648aa4f98a "NFS recover from destination server reboot for copies") used memcmp() and then it was changed to use nfs4_stateid_match_other() but that function returns opposite of memcmp. As the result, recovery can't find the copy leading to copy hanging. Fixes: 80f42368868e ("NFSv4: Split out NFS v4.2 copy completion functions") Fixes: cb7a8384dc02 ("NFS: Split out the body of nfs4_reclaim_open_state") Signed-of-by: Olga Kornievskaia <kolga@netapp.com> Signed-off-by: Anna Schumaker <Anna.Schumaker@Netapp.com>
| * | NFS: Fix NFSv4 symbolic trace point outputChuck Lever2019-01-021-143/+313
| | | | | | | | | | | | | | | | | | | | | | | | | | | These symbolic values were not being displayed in string form. TRACE_DEFINE_ENUM was missing in many cases. It also turns out that __print_symbolic wants an unsigned long in the first field... Signed-off-by: Chuck Lever <chuck.lever@oracle.com> Signed-off-by: Anna Schumaker <Anna.Schumaker@Netapp.com>
| * | NFS: Make "port=" mount option optional for RDMA mountsChuck Lever2019-01-021-2/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Having to specify "proto=rdma,port=20049" is cumbersome. RFC 8267 Section 6.3 requires NFSv4 clients to use "the alternative well-known port number", which is 20049. Make the use of the well- known port number automatic, just as it is for NFS/TCP and port 2049. For NFSv2/3, Section 4.2 allows clients to simply choose 20049 as the default or use rpcbind. I don't know of an NFS/RDMA server implementation that registers it's NFS/RDMA service with rpcbind, so automatically choosing 20049 seems like the better choice. The other widely-deployed NFS/RDMA client, Solaris, also uses 20049 as the default port. Signed-off-by: Chuck Lever <chuck.lever@oracle.com> Signed-off-by: Anna Schumaker <Anna.Schumaker@Netapp.com>
| * | NFS: nfs_compare_mount_options always compare auth flavors.Chris Perl2018-12-211-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This patch removes the check from nfs_compare_mount_options to see if a `sec' option was passed for the current mount before comparing auth flavors and instead just always compares auth flavors. Consider the following scenario: You have a server with the address 192.168.1.1 and two exports /export/a and /export/b. The first export supports `sys' and `krb5' security, the second just `sys'. Assume you start with no mounts from the server. The following results in EIOs being returned as the kernel nfs client incorrectly thinks it can share the underlying `struct nfs_server's: $ mkdir /tmp/{a,b} $ sudo mount -t nfs -o vers=3,sec=krb5 192.168.1.1:/export/a /tmp/a $ sudo mount -t nfs -o vers=3 192.168.1.1:/export/b /tmp/b $ df >/dev/null df: ā€˜/tmp/bā€™: Input/output error Signed-off-by: Chris Perl <cperl@janestreet.com> Signed-off-by: Anna Schumaker <Anna.Schumaker@Netapp.com>
| * | NFS/NFSD/SUNRPC: replace generic creds with 'struct cred'.NeilBrown2018-12-1926-307/+237
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | SUNRPC has two sorts of credentials, both of which appear as "struct rpc_cred". There are "generic credentials" which are supplied by clients such as NFS and passed in 'struct rpc_message' to indicate which user should be used to authorize the request, and there are low-level credentials such as AUTH_NULL, AUTH_UNIX, AUTH_GSS which describe the credential to be sent over the wires. This patch replaces all the generic credentials by 'struct cred' pointers - the credential structure used throughout Linux. For machine credentials, there is a special 'struct cred *' pointer which is statically allocated and recognized where needed as having a special meaning. A look-up of a low-level cred will map this to a machine credential. Signed-off-by: NeilBrown <neilb@suse.com> Acked-by: J. Bruce Fields <bfields@redhat.com> Signed-off-by: Anna Schumaker <Anna.Schumaker@Netapp.com>
| * | NFS: struct nfs_open_dir_context: convert rpc_cred pointer to cred.NeilBrown2018-12-194-17/+33
| | | | | | | | | | | | | | | | | | | | | Use the common 'struct cred' to pass credentials for readdir. Signed-off-by: NeilBrown <neilb@suse.com> Signed-off-by: Anna Schumaker <Anna.Schumaker@Netapp.com>
| * | NFS: change access cache to use 'struct cred'.NeilBrown2018-12-193-30/+39
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rather than keying the access cache with 'struct rpc_cred', use 'struct cred'. Then use cred_fscmp() to compare credentials rather than comparing the raw pointer. A benefit of this approach is that in the common case we avoid the rpc_lookup_cred_nonblock() call which can be slow when the cred cache is large. This also keeps many fewer items pinned in the rpc cred cache, so the cred cache is less likely to get large. Signed-off-by: NeilBrown <neilb@suse.com> Signed-off-by: Anna Schumaker <Anna.Schumaker@Netapp.com>
| * | NFS: move credential expiry tracking out of SUNRPC into NFS.NeilBrown2018-12-192-3/+23
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | NFS needs to know when a credential is about to expire so that it can modify write-back behaviour to finish the write inside the expiry time. It currently uses functions in SUNRPC code which make use of a fairly complex callback scheme and flags in the generic credientials. As I am working to discard the generic credentials, this has to change. This patch moves the logic into NFS, in part by finding and caching the low-level credential in the open_context. We then make direct cred-api calls on that. This makes the code much simpler and removes a dependency on generic rpc credentials. Signed-off-by: NeilBrown <neilb@suse.com> Signed-off-by: Anna Schumaker <Anna.Schumaker@Netapp.com>
| * | NFS/SUNRPC: don't lookup machine credential until rpcauth_bindcred().NeilBrown2018-12-194-42/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When NFS creates a machine credential, it is a "generic" credential, not tied to any auth protocol, and is really just a container for the princpal name. This doesn't get linked to a genuine credential until rpcauth_bindcred() is called. The lookup always succeeds, so various places that test if the machine credential is NULL, are pointless. As a step towards getting rid of generic credentials, this patch gets rid of generic machine credentials. The nfs_client and rpc_client just hold a pointer to a constant principal name. When a machine credential is wanted, a special static 'struct rpc_cred' pointer is used. rpcauth_bindcred() recognizes this, finds the principal from the client, and binds the correct credential. Signed-off-by: NeilBrown <neilb@suse.com> Signed-off-by: Anna Schumaker <Anna.Schumaker@Netapp.com>
| * | NFSv4: don't require lock for get_renew_cred or get_machine_credNeilBrown2018-12-194-25/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This lock is no longer necessary. If nfs4_get_renew_cred() needs to hunt through the open-state creds for a user cred, it still takes the lock to stablize the rbtree, but otherwise there are no races. Note that this completely removes the lock from nfs4_renew_state(). It appears that the original need for the locking here was removed long ago, and there is no longer anything to protect. Signed-off-by: NeilBrown <neilb@suse.com> Signed-off-by: Anna Schumaker <Anna.Schumaker@Netapp.com>
| * | NFSv4: add cl_root_cred for use when machine cred is not available.NeilBrown2018-12-192-8/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | NFSv4 state management tries a root credential when no machine credential is available, as can happen with kerberos. It does this by replacing the cl_machine_cred with a root credential. This means that any user of the machine credential needs to take a lock while getting a reference to the machine credential, which is a little cumbersome. So introduce an explicit cl_root_cred, and never free either credential until client shutdown. This means that no locking is needed to reference these credentials. Future patches will make use of this. This is only a temporary addition. both cl_machine_cred and cl_root_cred will disappear later in the series. Signed-off-by: NeilBrown <neilb@suse.com> Signed-off-by: Anna Schumaker <Anna.Schumaker@Netapp.com>
| * | SUNRPC: remove uid and gid from struct auth_credNeilBrown2018-12-192-10/+10
| | | | | | | | | | | | | | | | | | | | | Use cred->fsuid and cred->fsgid instead. Signed-off-by: NeilBrown <neilb@suse.com> Signed-off-by: Anna Schumaker <Anna.Schumaker@Netapp.com>
| * | SUNRPC: remove groupinfo from struct auth_cred.NeilBrown2018-12-191-13/+1
| | | | | | | | | | | | | | | | | | | | | We can use cred->groupinfo (from the 'struct cred') instead. Signed-off-by: NeilBrown <neilb@suse.com> Signed-off-by: Anna Schumaker <Anna.Schumaker@Netapp.com>
| * | SUNRPC: add 'struct cred *' to auth_cred and rpc_credNeilBrown2018-12-192-1/+29
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The SUNRPC credential framework was put together before Linux has 'struct cred'. Now that we have it, it makes sense to use it. This first step just includes a suitable 'struct cred *' pointer in every 'struct auth_cred' and almost every 'struct rpc_cred'. The rpc_cred used for auth_null has a NULL 'struct cred *' as nothing else really makes sense. For rpc_cred, the pointer is reference counted. For auth_cred it isn't. struct auth_cred are either allocated on the stack, in which case the thread owns a reference to the auth, or are part of 'struct generic_cred' in which case gc_base owns the reference, and "acred" shares it. Signed-off-by: NeilBrown <neilb@suse.com> Signed-off-by: Anna Schumaker <Anna.Schumaker@Netapp.com>
| * | nfs: fix comment to nfs_generic_pg_test which does the oppositePavel Tikhomirov2018-12-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Please see comment to filelayout_pg_test for reference. To: Trond Myklebust <trond.myklebust@hammerspace.com> Cc: Anna Schumaker <anna.schumaker@netapp.com> Cc: linux-nfs@vger.kernel.org Cc: linux-kernel@vger.kernel.org Signed-off-by: Pavel Tikhomirov <ptikhomirov@virtuozzo.com> Signed-off-by: Anna Schumaker <Anna.Schumaker@Netapp.com>
| * | NFSv4: cleanup remove unused nfs4_xdev_fs_typeOlga Kornievskaia2018-12-191-1/+0
| | | | | | | | | | | | | | | | | | | | | | | | commit e8f25e6d6d19 "NFS: Remove the NFS v4 xdev mount function" removed the last use of this. Signed-off-by: Olga Kornievskaia <kolga@netapp.com> Signed-off-by: Anna Schumaker <Anna.Schumaker@Netapp.com>
* | | Merge tag 'nfsd-4.21' of git://linux-nfs.org/~bfields/linuxLinus Torvalds2019-01-0312-69/+57
|\ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Pull nfsd updates from Bruce Fields: "Thanks to Vasily Averin for fixing a use-after-free in the containerized NFSv4.2 client, and cleaning up some convoluted backchannel server code in the process. Otherwise, miscellaneous smaller bugfixes and cleanup" * tag 'nfsd-4.21' of git://linux-nfs.org/~bfields/linux: (25 commits) nfs: fixed broken compilation in nfs_callback_up_net() nfs: minor typo in nfs4_callback_up_net() sunrpc: fix debug message in svc_create_xprt() sunrpc: make visible processing error in bc_svc_process() sunrpc: remove unused xpo_prep_reply_hdr callback sunrpc: remove svc_rdma_bc_class sunrpc: remove svc_tcp_bc_class sunrpc: remove unused bc_up operation from rpc_xprt_ops sunrpc: replace svc_serv->sv_bc_xprt by boolean flag sunrpc: use-after-free in svc_process_common() sunrpc: use SVC_NET() in svcauth_gss_* functions nfsd: drop useless LIST_HEAD lockd: Show pid of lockd for remote locks NFSD remove OP_CACHEME from 4.2 op_flags nfsd: Return EPERM, not EACCES, in some SETATTR cases sunrpc: fix cache_head leak due to queued request nfsd: clean up indentation, increase indentation in switch statement svcrdma: Optimize the logic that selects the R_key to invalidate nfsd: fix a warning in __cld_pipe_upcall() nfsd4: fix crash on writing v4_end_grace before nfsd startup ...
| * | | nfs: fixed broken compilation in nfs_callback_up_net()Vasily Averin2018-12-311-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Patch fixes compilation error in nfs_callback_up_net() serv->sv_bc_enabled is defined under enabled CONFIG_SUNRPC_BACKCHANNEL, however nfs_callback_up_net() can access it even if this config option was not set. Fixes: a289ce5311f4 (sunrpc: replace svc_serv->sv_bc_xprt by boolean flag) Reported-by: kbuild test robot <lkp@intel.com> Signed-off-by: Vasily Averin <vvs@virtuozzo.com> Signed-off-by: J. Bruce Fields <bfields@redhat.com>
| * | | nfs: minor typo in nfs4_callback_up_net()Vasily Averin2018-12-281-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Closing ")" was lost in debug message. Signed-off-by: Vasily Averin <vvs@virtuozzo.com> Signed-off-by: J. Bruce Fields <bfields@redhat.com>
| * | | sunrpc: replace svc_serv->sv_bc_xprt by boolean flagVasily Averin2018-12-281-3/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | svc_serv-> sv_bc_xprt is netns-unsafe and cannot be used as pointer. To prevent its misuse in future it is replaced by new boolean flag. Signed-off-by: Vasily Averin <vvs@virtuozzo.com> Signed-off-by: J. Bruce Fields <bfields@redhat.com>
| * | | nfsd: drop useless LIST_HEADJulia Lawall2018-12-281-1/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Drop LIST_HEAD where the variable it declares is never used. This was introduced in c5c707f96fc9a ("nfsd: implement pNFS layout recalls"), but was not used even in that commit. The semantic patch that fixes this problem is as follows: (http://coccinelle.lip6.fr/) // <smpl> @@ identifier x; @@ - LIST_HEAD(x); ... when != x // </smpl> Fixes: c5c707f96fc9a ("nfsd: implement pNFS layout recalls") Signed-off-by: Julia Lawall <Julia.Lawall@lip6.fr> Signed-off-by: J. Bruce Fields <bfields@redhat.com>
| * | | lockd: Show pid of lockd for remote locksBenjamin Coddington2018-12-143-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Commit 9d5b86ac13c5 ("fs/locks: Remove fl_nspid and use fs-specific l_pid for remote locks") specified that the l_pid returned for F_GETLK on a local file that has a remote lock should be the pid of the lock manager process. That commit, while updating other filesystems, failed to update lockd, such that locks created by lockd had their fl_pid set to that of the remote process holding the lock. Fix that here to be the pid of lockd. Also, fix the client case so that the returned lock pid is negative, which indicates a remote lock on a remote file. Fixes: 9d5b86ac13c5 ("fs/locks: Remove fl_nspid and use fs-specific...") Cc: stable@vger.kernel.org Signed-off-by: Benjamin Coddington <bcodding@redhat.com> Signed-off-by: J. Bruce Fields <bfields@redhat.com>
| * | | NFSD remove OP_CACHEME from 4.2 op_flagsOlga Kornievskaia2018-12-141-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | OP_CACHEME is only for the 4.0 operations. Signed-off-by: Olga Kornievskaia <kolga@netapp.com> Signed-off-by: J. Bruce Fields <bfields@redhat.com>
| * | | nfsd: Return EPERM, not EACCES, in some SETATTR caseszhengbin2018-12-051-2/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | As the man(2) page for utime/utimes states, EPERM is returned when the second parameter of utime or utimes is not NULL, the caller's effective UID does not match the owner of the file, and the caller is not privileged. However, in a NFS directory mounted from knfsd, it will return EACCES (from nfsd_setattr-> fh_verify->nfsd_permission). This patch fixes that. Signed-off-by: zhengbin <zhengbin13@huawei.com> Signed-off-by: J. Bruce Fields <bfields@redhat.com>
| * | | nfsd: clean up indentation, increase indentation in switch statementColin Ian King2018-11-291-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Trivial fix to clean up indentation, add in missing tabs. Signed-off-by: Colin Ian King <colin.king@canonical.com> Signed-off-by: J. Bruce Fields <bfields@redhat.com>
| * | | nfsd: fix a warning in __cld_pipe_upcall()Scott Mayhew2018-11-291-11/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | __cld_pipe_upcall() emits a "do not call blocking ops when !TASK_RUNNING" warning due to the dput() call in rpc_queue_upcall(). Fix it by using a completion instead of hand coding the wait. Signed-off-by: Scott Mayhew <smayhew@redhat.com> Signed-off-by: J. Bruce Fields <bfields@redhat.com>
| * | | nfsd4: fix crash on writing v4_end_grace before nfsd startupJ. Bruce Fields2018-11-291-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Anatoly Trosinenko reports that this: 1) Checkout fresh master Linux branch (tested with commit e195ca6cb) 2) Copy x84_64-config-4.14 to .config, then enable NFS server v4 and build 3) From `kvm-xfstests shell`: results in NULL dereference in locks_end_grace. Check that nfsd has been started before trying to end the grace period. Reported-by: Anatoly Trosinenko <anatoly.trosinenko@gmail.com> Signed-off-by: J. Bruce Fields <bfields@redhat.com>
| * | | lockd: fix decoding of TEST resultsJ. Bruce Fields2018-11-272-32/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We fail to advance the read pointer when reading the stat.oh field that identifies the lock-holder in a TEST result. This turns out not to matter if the server is knfsd, which always returns a zero-length field. But other servers (Ganesha is an example) may not do this. The result is bad values in fcntl F_GETLK results. Fix this. Signed-off-by: J. Bruce Fields <bfields@redhat.com>
| * | | nfsd4: skip unused assignmentJ. Bruce Fields2018-11-271-1/+1
| | | | | | | | | | | | | | | | Signed-off-by: J. Bruce Fields <bfields@redhat.com>
| * | | nfsd4: forbid all renames during grace periodJ. Bruce Fields2018-11-271-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The idea here was that renaming a file on a nosubtreecheck export would make lookups of the old filehandle return STALE, making it impossible for clients to reclaim opens. But during the grace period I think we should also hold off on operations that would break delegations. Signed-off-by: J. Bruce Fields <bfields@redhat.com>
| * | | nfsd4: remove unused nfs4_check_olstateid parameterJ. Bruce Fields2018-11-271-2/+2
| | | | | | | | | | | | | | | | Signed-off-by: J. Bruce Fields <bfields@redhat.com>
| * | | nfsd4: zero-length WRITE should succeedJ. Bruce Fields2018-11-271-2/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Zero-length writes are legal; from 5661 section 18.32.3: "If the count is zero, the WRITE will succeed and return a count of zero subject to permissions checking". This check is unnecessary and is causing zero-length reads to return EINVAL. Cc: stable@vger.kernel.org Fixes: 3fd9557aec91 "NFSD: Refactor the generic write vector fill helper" Cc: Chuck Lever <chuck.lever@oracle.com> Signed-off-by: J. Bruce Fields <bfields@redhat.com>
* | | | Merge tag '4.21-smb3-fixes' of git://git.samba.org/sfrench/cifs-2.6Linus Torvalds2019-01-0227-501/+2842
|\ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Pull cifs updates from Steve French: - four fixes for stable - improvements to DFS including allowing failover to alternate targets - some small performance improvements * tag '4.21-smb3-fixes' of git://git.samba.org/sfrench/cifs-2.6: (39 commits) cifs: update internal module version number cifs: we can not use small padding iovs together with encryption cifs: Minor Kconfig clarification cifs: Always resolve hostname before reconnecting cifs: Add support for failover in cifs_reconnect_tcon() cifs: Add support for failover in smb2_reconnect() cifs: Only free DFS target list if we actually got one cifs: start DFS cache refresher in cifs_mount() cifs: Use GFP_ATOMIC when a lock is held in cifs_mount() cifs: Add support for failover in cifs_reconnect() cifs: Add support for failover in cifs_mount() cifs: remove set but not used variable 'sep' cifs: Make use of DFS cache to get new DFS referrals cifs: minor updates to documentation cifs: check kzalloc return cifs: remove set but not used variable 'server' cifs: Use kzfree() to free password cifs: Fix to use kmem_cache_free() instead of kfree() cifs: update for current_kernel_time64() removal cifs: Add DFS cache routines ...
| * | | | cifs: update internal module version numberSteve French2018-12-311-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | To version 2.15 Signed-off-by: Steve French <stfrench@microsoft.com>
| * | | | cifs: we can not use small padding iovs together with encryptionRonnie Sahlberg2018-12-313-33/+55
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can not append small padding buffers as separate iovs when encryption is used. For this case we must flatten the request into a single buffer containing both the data from all the iovs as well as the padding bytes. This is at least needed for 4.20 as well due to compounding changes. CC: Stable <stable@vger.kernel.org> Signed-off-by: Ronnie Sahlberg <lsahlber@redhat.com> Signed-off-by: Steve French <stfrench@microsoft.com>
| * | | | cifs: Minor Kconfig clarificationSteve French2018-12-281-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Clarify the use of the CONFIG_DFS_UPCALL for DNS name resolution when server ip addresses change (e.g. on long running mounts) Signed-off-by: Steve French <stfrench@microsoft.com>
| * | | | cifs: Always resolve hostname before reconnectingPaulo Alcantara2018-12-281-32/+52
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In case a hostname resolves to a different IP address (e.g. long running mounts), make sure to resolve it every time prior to calling generic_ip_connect() in reconnect. Suggested-by: Steve French <stfrench@microsoft.com> Signed-off-by: Paulo Alcantara <palcantara@suse.de> Signed-off-by: Steve French <stfrench@microsoft.com>
| * | | | cifs: Add support for failover in cifs_reconnect_tcon()Paulo Alcantara2018-12-281-3/+85
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | After a successful failover, the cifs_reconnect_tcon() function will make sure to reconnect every tcon to new target server. Same as previous commit but for SMB1 codepath. Signed-off-by: Paulo Alcantara <palcantara@suse.de> Reviewed-by: Aurelien Aptel <aaptel@suse.com> Signed-off-by: Steve French <stfrench@microsoft.com>
| * | | | cifs: Add support for failover in smb2_reconnect()Paulo Alcantara2018-12-283-3/+104
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | After a successful failover in cifs_reconnect(), the smb2_reconnect() function will make sure to reconnect every tcon to new target server. For SMB2+. Signed-off-by: Paulo Alcantara <palcantara@suse.de> Signed-off-by: Aurelien Aptel <aaptel@suse.com> Signed-off-by: Steve French <stfrench@microsoft.com>
| * | | | cifs: Only free DFS target list if we actually got onePaulo Alcantara2018-12-281-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fix potential NULL ptr deref when DFS target list is empty. Signed-off-by: Paulo Alcantara <palcantara@suse.de> Reviewed-by: Aurelien Aptel <aaptel@suse.com> Signed-off-by: Steve French <stfrench@microsoft.com>
| * | | | cifs: start DFS cache refresher in cifs_mount()Paulo Alcantara2018-12-281-0/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Start the DFS cache refresh worker per volume during cifs mount. Signed-off-by: Paulo Alcantara <palcantara@suse.de> Reviewed-by: Aurelien Aptel <aaptel@suse.de> Signed-off-by: Steve French <stfrench@microsoft.com>
| * | | | cifs: Use GFP_ATOMIC when a lock is held in cifs_mount()YueHaibing2018-12-281-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | A spin lock is held before kstrndup, it may sleep with holding the spinlock, so we should use GFP_ATOMIC instead. Fixes: e58c31d5e387 ("cifs: Add support for failover in cifs_reconnect()") Signed-off-by: YueHaibing <yuehaibing@huawei.com> Signed-off-by: Steve French <stfrench@microsoft.com> Reviewed-by: Paulo Alcantara <palcantara@suse.de>
| * | | | cifs: Add support for failover in cifs_reconnect()Paulo Alcantara2018-12-283-1/+204
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | After failing to reconnect to original target, it will retry any target available from DFS cache. Signed-off-by: Paulo Alcantara <palcantara@suse.de> Reviewed-by: Aurelien Aptel <aaptel@suse.com> Signed-off-by: Steve French <stfrench@microsoft.com>
| * | | | cifs: Add support for failover in cifs_mount()Paulo Alcantara2018-12-283-15/+236
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This patch adds support for failover when failing to connect in cifs_mount(). Signed-off-by: Paulo Alcantara <palcantara@suse.de> Reviewed-by: Aurelien Aptel <aaptel@suse.com> Signed-off-by: Steve French <stfrench@microsoft.com>