summaryrefslogtreecommitdiffstats
path: root/fs (follow)
Commit message (Expand)AuthorAgeFilesLines
* userfaultfd: clear flag if remap event not enabledPeter Xu2018-12-281-1/+9
* mm, proc: report PR_SET_THP_DISABLE in procMichal Hocko2018-12-281-0/+10
* mm, thp, proc: report THP eligibility for each vmaMichal Hocko2018-12-281-0/+2
* mm/mmu_notifier: use structure for invalidate_range_start/end calls v2Jérôme Glisse2018-12-282-5/+10
* /proc/kpagecount: return 0 for special pages that are never mappedAnthony Yznaga2018-12-281-1/+1
* userfaultfd: convert userfaultfd_ctx::refcount to refcount_tEric Biggers2018-12-281-6/+5
* mm: convert totalram_pages and totalhigh_pages variables to atomicArun KS2018-12-287-7/+7
* mm: reference totalram_pages and managed_pages once per functionArun KS2018-12-281-3/+4
* ocfs2: don't clear bh uptodate for block readJunxiao Bi2018-12-281-2/+0
* ocfs2: clear journal dirty flag after shutdown journalJunxiao Bi2018-12-281-4/+2
* ocfs2: fix panic due to unrecovered local allocJunxiao Bi2018-12-281-2/+7
* ocfs2: improve ocfs2 MakefileLarry Chen2018-12-283-3/+3
* ocfs2: remove set but not used variable 'lastzero'zhong jiang2018-12-281-2/+1
* ocfs2: dlmfs: remove set but not used variable 'status'zhong jiang2018-12-281-2/+1
* ocfs2: optimize the reading of heartbeat dataJia Guo2018-12-281-5/+12
* Merge tag 'locks-v4.21-1' of git://git.kernel.org/pub/scm/linux/kernel/git/jl...Linus Torvalds2018-12-287-146/+236
|\
| * locks: Use inode_is_open_for_writeNikolay Borisov2018-12-171-1/+1
| * fs/locks: remove unnecessary white space.NeilBrown2018-12-071-21/+12
| * fs/locks: merge posix_unblock_lock() and locks_delete_block()NeilBrown2018-12-074-29/+19
| * fs/locks: create a tree of dependent requests.NeilBrown2018-12-071-6/+63
| * fs/locks: change all *_conflict() functions to return bool.NeilBrown2018-12-071-12/+15
| * fs/locks: always delete_block after waiting.NeilBrown2018-12-071-16/+24
| * fs/locks: allow a lock request to block other requests.NeilBrown2018-11-301-6/+37
| * fs/locks: use properly initialized file_lock when unlocking.NeilBrown2018-11-301-14/+14
| * ocfs2: properly initial file_lock used for unlock.NeilBrown2018-11-301-5/+5
| * gfs2: properly initial file_lock used for unlock.NeilBrown2018-11-301-5/+5
| * NFS: use locks_copy_lock() to copy locks.NeilBrown2018-11-301-2/+4
| * fs/locks: split out __locks_wake_up_blocks().NeilBrown2018-11-301-11/+16
| * fs/locks: rename some lists and pointers.NeilBrown2018-11-302-29/+32
* | Merge tag 'ext4_for_linus' of git://git.kernel.org/pub/scm/linux/kernel/git/t...Linus Torvalds2018-12-2813-174/+272
|\ \
| * | ext4: check for shutdown and r/o file system in ext4_write_inode()Theodore Ts'o2018-12-191-2/+7
| * | ext4: force inode writes when nfsd calls commit_metadata()Theodore Ts'o2018-12-191-0/+11
| * | ext4: avoid declaring fs inconsistent due to invalid file handlesTheodore Ts'o2018-12-198-41/+65
| * | ext4: include terminating u32 in size of xattr entries when expanding inodesTheodore Ts'o2018-12-191-1/+1
| * | ext4: compare old and new mode before setting update_mode flagChengguang Xu2018-12-101-1/+2
| * | ext4: fix EXT4_IOC_GROUP_ADD ioctlruippan (潘睿)2018-12-041-1/+1
| * | ext4: hard fail dax mount on unsupported devicesEric Sandeen2018-12-041-3/+3
| * | ext4: remove redundant condition checkChengguang Xu2018-12-041-16/+13
| * | jbd2: clean up indentation issue, replace spaces with tabColin Ian King2018-12-041-1/+1
| * | ext4: clean up indentation issues, remove extraneous tabsColin Ian King2018-12-042-7/+7
| * | ext4: missing unlock/put_page() in ext4_try_to_write_inline_data()Maurizio Lombardi2018-12-041-1/+4
| * | ext4: fix possible use after free in ext4_quota_enablePan Bian2018-12-041-1/+1
| * | jbd2: avoid long hold times of j_state_lock while committing a transactionJan Kara2018-12-042-5/+41
| * | ext4: add ext4_sb_bread() to disambiguate ENOMEM casesTheodore Ts'o2018-11-255-94/+115
* | | Merge tag 'iomap-4.21-merge-2' of git://git.kernel.org/pub/scm/fs/xfs/xfs-linuxLinus Torvalds2018-12-281-2/+15
|\ \ \
| * | | iomap: don't search past page end in iomap_is_partially_uptodateEric Sandeen2018-12-211-2/+15
* | | | Merge tag 'xfs-4.21-merge-2' of git://git.kernel.org/pub/scm/fs/xfs/xfs-linuxLinus Torvalds2018-12-2851-714/+932
|\ \ \ \
| * | | | xfs: reallocate realtime summary cache on growfsOmar Sandoval2018-12-221-8/+36
| * | | | xfs: stringify scrub types in ftrace outputDarrick J. Wong2018-12-192-28/+79
| * | | | xfs: stringify btree cursor types in ftrace outputDarrick J. Wong2018-12-193-14/+49